|
CAS#: 921-13-1 Product: Chlorodinitromethane No suppilers available for the product. |
| Name | Chlorodinitromethane |
|---|---|
| Synonyms | Chloro-Dinitro-Methane; 3-01-00-00115 (Beilstein Handbook Reference); Brn 1764438 |
| Molecular Structure | ![]() |
| Molecular Formula | CHClN2O4 |
| Molecular Weight | 140.48 |
| CAS Registry Number | 921-13-1 |
| SMILES | O=[N+](C(Cl)[N+]([O-])=O)[O-] |
| InChI | 1S/CHClN2O4/c2-1(3(5)6)4(7)8/h1H |
| InChIKey | ZRZHWNKHBGRJKD-UHFFFAOYSA-N |
| Density | 1.706g/cm3 (Cal.) |
|---|---|
| Boiling point | 150.725°C at 760 mmHg (Cal.) |
| Flash point | 44.957°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chlorodinitromethane |