|
CAS#: 92153-25-8 Product: 2,2-Bis[(4-Chlorophenyl)Sulfanyl]Acetic Acid No suppilers available for the product. |
| Name | 2,2-Bis[(4-Chlorophenyl)Sulfanyl]Acetic Acid |
|---|---|
| Synonyms | 2,2-Bis[(4-Chlorophenyl)Thio]Acetic Acid; 2,2-Bis[(4-Chlorophenyl)Sulfanyl]Ethanoic Acid; Ncistruc2_001411 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10Cl2O2S2 |
| Molecular Weight | 345.26 |
| CAS Registry Number | 92153-25-8 |
| SMILES | C2=C(SC(C(O)=O)SC1=CC=C(Cl)C=C1)C=CC(=C2)Cl |
| InChI | 1S/C14H10Cl2O2S2/c15-9-1-5-11(6-2-9)19-14(13(17)18)20-12-7-3-10(16)4-8-12/h1-8,14H,(H,17,18) |
| InChIKey | USBNCBWTGNVEEO-UHFFFAOYSA-N |
| Density | 1.512g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.644°C at 760 mmHg (Cal.) |
| Flash point | 248.719°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Bis[(4-Chlorophenyl)Sulfanyl]Acetic Acid |