|
CAS#: 92257-40-4 Product: Dizatrifone No suppilers available for the product. |
| Name | Dizatrifone |
|---|---|
| Synonyms | Dizatrifonum [Latin]; 2-(Cyclopropylmethyl)-5,6-Bis(P-Methoxyphenyl)-As-Triazin-3(2H)-One; Dizatrifona [Spanish] |
| Molecular Structure | ![]() |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 |
| CAS Registry Number | 92257-40-4 |
| SMILES | C4=C(C2=NN(CC1CC1)C(N=C2C3=CC=C(C=C3)OC)=O)C=CC(=C4)OC |
| InChI | 1S/C21H21N3O3/c1-26-17-9-5-15(6-10-17)19-20(16-7-11-18(27-2)12-8-16)23-24(21(25)22-19)13-14-3-4-14/h5-12,14H,3-4,13H2,1-2H3 |
| InChIKey | DMEHEIWCWDNUBJ-UHFFFAOYSA-N |
| Density | 1.274g/cm3 (Cal.) |
|---|---|
| Boiling point | 502.511°C at 760 mmHg (Cal.) |
| Flash point | 257.709°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dizatrifone |