| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 3,4-Methylenedioxymethamphetamine hydrochloride |
|---|---|
| Synonyms | 1-(1,3-Benzodioxol-5-Yl)-N-Methyl-Propan-2-Amine Hydrochloride; [2-(1,3-Benzodioxol-5-Yl)-1-Methyl-Ethyl]-Methyl-Amine Hydrochloride; 1,3-Benzodioxole-5-Ethanamine, N,.Alpha.-Dimethyl-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 |
| CAS Registry Number | 92279-84-0 |
| SMILES | [H+].C1=C(C=CC2=C1OCO2)CC(NC)C.[Cl-] |
| InChI | 1S/C11H15NO2.ClH/c1-8(12-2)5-9-3-4-10-11(6-9)14-7-13-10;/h3-4,6,8,12H,5,7H2,1-2H3;1H |
| InChIKey | LUWHVONVCYWRMZ-UHFFFAOYSA-N |
| Boiling point | 283.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 113.2°C (Cal.) |
| solubility | Soluble to 100 mM in water |
| Market Analysis Reports |
| List of Reports Available for 3,4-Methylenedioxymethamphetamine hydrochloride |