|
CAS#: 923569-79-3 Product: 2-(Heptafluoropropyl)-5-methoxy-1H-indole No suppilers available for the product. |
| Name | 2-(Heptafluoropropyl)-5-methoxy-1H-indole |
|---|---|
| Synonyms | 1H-Indole, 2-(1,1,2,2,3,3,3-heptafluoropropyl)-5-methoxy-; 2-(Heptafluoropropyl)-5-methoxy-1H-indole; 2-(Heptafluoropropyl)-5-méthoxy-1H-indole |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8F7NO |
| Molecular Weight | 315.19 |
| CAS Registry Number | 923569-79-3 |
| SMILES | COc1ccc2c(c1)cc([nH]2)C(C(C(F)(F)F)(F)F)(F)F |
| InChI | 1S/C12H8F7NO/c1-21-7-2-3-8-6(4-7)5-9(20-8)10(13,14)11(15,16)12(17,18)19/h2-5,20H,1H3 |
| InChIKey | ASWZKBOTOHYLHW-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 297.3±40.0°C at 760 mmHg (Cal.) |
| Flash point | 133.6±27.3°C (Cal.) |
| Refractive index | 1.472 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Heptafluoropropyl)-5-methoxy-1H-indole |