|
CAS#: 92426-30-7 Product: 1,3-Dibromo-5,5-Diphenylimidazolidine-2,4-Dione No suppilers available for the product. |
| Name | 1,3-Dibromo-5,5-Diphenylimidazolidine-2,4-Dione |
|---|---|
| Synonyms | 1,3-Dibromo-5,5-Di(Phenyl)Hydantoin; 1,3-Dibromo-5,5-Diphenylimidazolidine-2,4-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10Br2N2O2 |
| Molecular Weight | 410.06 |
| CAS Registry Number | 92426-30-7 |
| EINECS | 296-232-7 |
| SMILES | C3=C(C2(C1=CC=CC=C1)C(N(Br)C(N2Br)=O)=O)C=CC=C3 |
| InChI | 1S/C15H10Br2N2O2/c16-18-13(20)15(19(17)14(18)21,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | YHELUCUIFBBFGG-UHFFFAOYSA-N |
| Density | 1.869g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.748°C at 760 mmHg (Cal.) |
| Flash point | 225.195°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dibromo-5,5-Diphenylimidazolidine-2,4-Dione |