|
CAS#: 924854-60-4 Product: 3-Isobutyl-9,10-dimethoxy-1,3,4,6,7,11b-hexahydro-2H-pyrido[2,1-a]isoquinolin-2-ol No suppilers available for the product. |
| Name | 3-Isobutyl-9,10-dimethoxy-1,3,4,6,7,11b-hexahydro-2H-pyrido[2,1-a]isoquinolin-2-ol |
|---|---|
| Synonyms | 2H-benzo[ |
| Molecular Structure | ![]() |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 |
| CAS Registry Number | 924854-60-4 |
| SMILES | O(c1cc3c(cc1OC)C2N(CC(C(O)C2)CC(C)C)CC3)C |
| InChI | 1S/C19H29NO3/c1-12(2)7-14-11-20-6-5-13-8-18(22-3)19(23-4)9-15(13)16(20)10-17(14)21/h8-9,12,14,16-17,21H,5-7,10-11H2,1-4H3 |
| InChIKey | WEQLWGNDNRARGE-UHFFFAOYSA-N |
| Density | 1.13g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.82°C at 760 mmHg (Cal.) |
| Flash point | 230.682°C (Cal.) |
| Refractive index | 1.562 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Isobutyl-9,10-dimethoxy-1,3,4,6,7,11b-hexahydro-2H-pyrido[2,1-a]isoquinolin-2-ol |