|
CAS#: 92549-67-2 Product: 2,2-Bis(4-Hydroxyphenyl)-Propanoic Acid No suppilers available for the product. |
| Name | 2,2-Bis(4-Hydroxyphenyl)-Propanoic Acid |
|---|---|
| Synonyms | 2,2-Bis(4-Hydroxyphenyl)Propionic Acid; Chebi:19287; 2,2-Bis(4-Hydroxyphenyl)-Propanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 |
| CAS Registry Number | 92549-67-2 |
| SMILES | C2=C(C(C1=CC=C(O)C=C1)(C(=O)O)C)C=CC(=C2)O |
| InChI | 1S/C15H14O4/c1-15(14(18)19,10-2-6-12(16)7-3-10)11-4-8-13(17)9-5-11/h2-9,16-17H,1H3,(H,18,19) |
| InChIKey | YWXSOBSAHZIXED-UHFFFAOYSA-N |
| Density | 1.33g/cm3 (Cal.) |
|---|---|
| Boiling point | 486.9°C at 760 mmHg (Cal.) |
| Flash point | 262.372°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Bis(4-Hydroxyphenyl)-Propanoic Acid |