|
CAS#: 926-52-3 Product: Thiosulfuric acid S-[2-[(1,1-dimethylethyl)amino]ethyl] ester No suppilers available for the product. |
| Name | Thiosulfuric acid S-[2-[(1,1-dimethylethyl)amino]ethyl] ester |
|---|---|
| Synonyms | 2-Methyl-2-[2-(Sulfothio)Ethylamino]Propane; 1-(Tert-Butylamino)-2-(Sulfothio)Ethane; Thiosulfuric Acid, S-(2-((1,1-Dimethylethyl)Amino)Ethyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C6H15NO3S2 |
| Molecular Weight | 213.31 |
| CAS Registry Number | 926-52-3 |
| SMILES | C(S[S](=O)(=O)O)CNC(C)(C)C |
| InChI | 1S/C6H15NO3S2/c1-6(2,3)7-4-5-11-12(8,9)10/h7H,4-5H2,1-3H3,(H,8,9,10) |
| InChIKey | DEGNVZJJUSWXDF-UHFFFAOYSA-N |
| Density | 1.263g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Thiosulfuric acid S-[2-[(1,1-dimethylethyl)amino]ethyl] ester |