|
CAS#: 92615-20-8 Product: Nafenodone No suppilers available for the product. |
| Name | Nafenodone |
|---|---|
| Synonyms | 2-(2-Dimethylaminoethyl)-2-Phenyl-Tetralin-1-One; 2-(2-Dimethylaminoethyl)-2-Phenyl-1-Tetralinone; Nafenodone [Inn] |
| Molecular Structure | ![]() |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 |
| CAS Registry Number | 92615-20-8 |
| SMILES | C3=C(C2(C(C1=C(C=CC=C1)CC2)=O)CCN(C)C)C=CC=C3 |
| InChI | 1S/C20H23NO/c1-21(2)15-14-20(17-9-4-3-5-10-17)13-12-16-8-6-7-11-18(16)19(20)22/h3-11H,12-15H2,1-2H3 |
| InChIKey | IOKKIRANVRFSAH-UHFFFAOYSA-N |
| Density | 1.074g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.102°C at 760 mmHg (Cal.) |
| Flash point | 154.199°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Nafenodone |