|
CAS#: 92687-89-3 Product: 11-Chloromethylene Pentacyclo[5.4.0.02,6.03,10.05,9]Undecan-8-One No suppilers available for the product. |
| Name | 11-Chloromethylene Pentacyclo[5.4.0.02,6.03,10.05,9]Undecan-8-One |
|---|---|
| Synonyms | 11-Chloromethylene Pentacyclo[5.4.0.02,6.03,10.05,9]Undecan-8-One |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11ClO |
| Molecular Weight | 206.67 |
| CAS Registry Number | 92687-89-3 |
| SMILES | O=C2C1C3C4C1\C(C5C2C3CC45)=C\Cl |
| InChI | 1S/C12H11ClO/c13-2-5-6-3-1-4-8-7(3)9(5)11(8)12(14)10(4)6/h2-4,6-11H,1H2/b5-2+ |
| InChIKey | MJZGJTGOOMRSNK-GORDUTHDSA-N |
| Density | 1.617g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.755°C at 760 mmHg (Cal.) |
| Flash point | 161.291°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11-Chloromethylene Pentacyclo[5.4.0.02,6.03,10.05,9]Undecan-8-One |