|
CAS#: 92788-09-5 Product: 4,4-Dimethylthiochroman-6-Yl Methyl Ketone 1,1-Dioxide No suppilers available for the product. |
| Name | 4,4-Dimethylthiochroman-6-Yl Methyl Ketone 1,1-Dioxide |
|---|---|
| Synonyms | 1-(1,1-Diketo-4,4-Dimethyl-2,3-Dihydrothiochromen-6-Yl)Ethanone; 4,4-Dckd; 4,4-Dimethylthiochroman-6-Yl Methyl Ketone 1,1-Dioxide |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16O3S |
| Molecular Weight | 252.33 |
| CAS Registry Number | 92788-09-5 |
| SMILES | C1=C(C=C2C(=C1)[S](CCC2(C)C)(=O)=O)C(C)=O |
| InChI | 1S/C13H16O3S/c1-9(14)10-4-5-12-11(8-10)13(2,3)6-7-17(12,15)16/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | ICHLZFTYIRCGMT-UHFFFAOYSA-N |
| Density | 1.186g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.67°C at 760 mmHg (Cal.) |
| Flash point | 286.077°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4-Dimethylthiochroman-6-Yl Methyl Ketone 1,1-Dioxide |