|
CAS#: 92851-98-4 Product: 2-Propyl-10H-Phenothiazine No suppilers available for the product. |
| Name | 2-Propyl-10H-Phenothiazine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H15NS |
| Molecular Weight | 241.35 |
| CAS Registry Number | 92851-98-4 |
| EINECS | 296-607-5 |
| SMILES | C1=C(CCC)C=CC2=C1NC3=C(S2)C=CC=C3 |
| InChI | 1S/C15H15NS/c1-2-5-11-8-9-15-13(10-11)16-12-6-3-4-7-14(12)17-15/h3-4,6-10,16H,2,5H2,1H3 |
| InChIKey | ZDVDHZUTWCNCHL-UHFFFAOYSA-N |
| Density | 1.144g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.091°C at 760 mmHg (Cal.) |
| Flash point | 195.768°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Propyl-10H-Phenothiazine |