|
CAS#: 928713-68-2 Product: 3-Amino-3-[2-(3,5-dimethoxyphenyl)-5-pyrimidinyl]propanoic acid No suppilers available for the product. |
| Name | 3-Amino-3-[2-(3,5-dimethoxyphenyl)-5-pyrimidinyl]propanoic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.31 |
| CAS Registry Number | 928713-68-2 |
| SMILES | COc1cc(cc(c1)OC)c2ncc(cn2)C(CC(=O)O)N |
| InChI | 1S/C15H17N3O4/c1-21-11-3-9(4-12(5-11)22-2)15-17-7-10(8-18-15)13(16)6-14(19)20/h3-5,7-8,13H,6,16H2,1-2H3,(H,19,20) |
| InChIKey | PVQWLGKROXREAX-UHFFFAOYSA-N |
| Density | 1.277g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.986°C at 760 mmHg (Cal.) |
| Flash point | 229.572°C (Cal.) |
| Refractive index | 1.586 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-3-[2-(3,5-dimethoxyphenyl)-5-pyrimidinyl]propanoic acid |