|
CAS#: 92900-69-1 Product: 2-Isobutyl-3,5-diisopropyl-1,2-dihydropyridine No suppilers available for the product. |
| Name | 2-Isobutyl-3,5-diisopropyl-1,2-dihydropyridine |
|---|---|
| Synonyms | 2-Isobutyl-3,5-diisopropyl-1,2-dihydropyridine # |
| Molecular Structure | ![]() |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.38 |
| CAS Registry Number | 92900-69-1 |
| SMILES | C1(=C/C(=C\NC1CC(C)C)C(C)C)\C(C)C |
| InChI | 1S/C15H27N/c1-10(2)7-15-14(12(5)6)8-13(9-16-15)11(3)4/h8-12,15-16H,7H2,1-6H3 |
| InChIKey | YYFTXQSCZVIWJZ-UHFFFAOYSA-N |
| Density | 0.851g/cm3 (Cal.) |
|---|---|
| Boiling point | 308.76°C at 760 mmHg (Cal.) |
| Flash point | 137.894°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Isobutyl-3,5-diisopropyl-1,2-dihydropyridine |