|
CAS#: 93-31-2 Product: N-[2-(3,4-Dimethoxyphenyl)-1-methylethyl]-4-ethoxy-3-methoxyphenylacetamide No suppilers available for the product. |
| Name | N-[2-(3,4-Dimethoxyphenyl)-1-methylethyl]-4-ethoxy-3-methoxyphenylacetamide |
|---|---|
| Synonyms | (Z)-7-[(1S,4R,5R,6R)-5-[(E,3S)-4-(4-Fluorophenoxy)-3-Hydroxy-But-1-Enyl]-7-Oxabicyclo[2.2.1]Heptan-6-Yl]Hept-5-Enoic Acid; Ep171 |
| Molecular Structure | ![]() |
| Molecular Formula | C23H29FO5 |
| Molecular Weight | 404.48 |
| CAS Registry Number | 93-31-2 |
| EINECS | 202-238-2 |
| SMILES | [C@@H]1([C@H]3O[C@@H]([C@@H]1\C=C\[C@H](O)COC2=CC=C(F)C=C2)CC3)C\C=C/CCCC(O)=O |
| InChI | 1S/C23H29FO5/c24-16-7-10-18(11-8-16)28-15-17(25)9-12-20-19(21-13-14-22(20)29-21)5-3-1-2-4-6-23(26)27/h1,3,7-12,17,19-22,25H,2,4-6,13-15H2,(H,26,27)/b3-1-,12-9+/t17-,19+,20+,21-,22+/m0/s1 |
| InChIKey | JEUSDRLWFSRHSX-XUEDOEMRSA-N |
| Density | 1.235g/cm3 (Cal.) |
|---|---|
| Boiling point | 585.351°C at 760 mmHg (Cal.) |
| Flash point | 307.809°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[2-(3,4-Dimethoxyphenyl)-1-methylethyl]-4-ethoxy-3-methoxyphenylacetamide |