|
CAS#: 93020-27-0 Product: Diethyl 2-[(5-Nitro-1H-Indol-3-Yl)Methyl]Propanedioate No suppilers available for the product. |
| Name | Diethyl 2-[(5-Nitro-1H-Indol-3-Yl)Methyl]Propanedioate |
|---|---|
| Synonyms | 2-[(5-Nitro-1H-Indol-3-Yl)Methyl]Propanedioic Acid Diethyl Ester; 2-[(5-Nitro-1H-Indol-3-Yl)Methyl]Malonic Acid Diethyl Ester; Nciopen2_009373 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18N2O6 |
| Molecular Weight | 334.33 |
| CAS Registry Number | 93020-27-0 |
| SMILES | C1=CC(=CC2=C1[NH]C=C2CC(C(=O)OCC)C(=O)OCC)[N+]([O-])=O |
| InChI | 1S/C16H18N2O6/c1-3-23-15(19)13(16(20)24-4-2)7-10-9-17-14-6-5-11(18(21)22)8-12(10)14/h5-6,8-9,13,17H,3-4,7H2,1-2H3 |
| InChIKey | CWOWTBUJIGHWHF-UHFFFAOYSA-N |
| Density | 1.322g/cm3 (Cal.) |
|---|---|
| Boiling point | 499.755°C at 760 mmHg (Cal.) |
| Flash point | 256.043°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl 2-[(5-Nitro-1H-Indol-3-Yl)Methyl]Propanedioate |