|
CAS#: 930778-46-4 Product: N-[2-(Bromomethyl)-5-Fluorophenyl]-2,2,2-Trifluoroacetimidoyl Chloride No suppilers available for the product. |
| Name | N-[2-(Bromomethyl)-5-Fluorophenyl]-2,2,2-Trifluoroacetimidoyl Chloride |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H5BrClF4N |
| Molecular Weight | 318.49 |
| CAS Registry Number | 930778-46-4 |
| SMILES | BrCc1c(\N=C(/Cl)C(F)(F)F)cc(F)cc1 |
| InChI | 1S/C9H5BrClF4N/c10-4-5-1-2-6(12)3-7(5)16-8(11)9(13,14)15/h1-3H,4H2/b16-8- |
| InChIKey | NAQROJVNWKJABU-PXNMLYILSA-N |
| Density | 1.654g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.131°C at 760 mmHg (Cal.) |
| Flash point | 126.848°C (Cal.) |
| Refractive index | 1.5 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[2-(Bromomethyl)-5-Fluorophenyl]-2,2,2-Trifluoroacetimidoyl Chloride |