Online Database of Chemicals from Around the World
|
CAS#: 93265-41-9 Product: (2'-Methoxyvinyl)Pyrene No suppilers available for the product. |
| Name | (2'-Methoxyvinyl)Pyrene |
|---|---|
| Synonyms | 1-[(E)-2-Methoxyvinyl]Pyrene; Trans-Mvp; (2'-Methoxyvinyl)Pyrene |
| Molecular Structure |  |
| Molecular Formula | C19H14O |
| Molecular Weight | 258.32 |
| CAS Registry Number | 93265-41-9 |
| SMILES | C3=CC1=CC=CC2=C1C4=C(C=C2)C=CC(=C34)\C=C\OC |
| InChI | 1S/C19H14O/c1-20-12-11-13-5-6-16-8-7-14-3-2-4-15-9-10-17(13)19(16)18(14)15/h2-12H,1H3/b12-11+ |
| InChIKey | SGTJXHYDKUXJRK-VAWYXSNFSA-N |
| Density | 1.234g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.371°C at 760 mmHg (Cal.) |
| Flash point | 213.799°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2'-Methoxyvinyl)Pyrene |