|
CAS#: 933453-51-1 Product: Methyl (2R)-1-(4-fluorophenyl)-2-aziridinecarboxylate No suppilers available for the product. |
| Name | Methyl (2R)-1-(4-fluorophenyl)-2-aziridinecarboxylate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 |
| CAS Registry Number | 933453-51-1 |
| SMILES | Fc1ccc(cc1)N2[C@@H](C(=O)OC)C2 |
| InChI | 1S/C10H10FNO2/c1-14-10(13)9-6-12(9)8-4-2-7(11)3-5-8/h2-5,9H,6H2,1H3/t9-,12?/m1/s1 |
| InChIKey | HUSNYYFBCNWYKS-PKEIRNPWSA-N |
| Density | 1.299g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.08°C at 760 mmHg (Cal.) |
| Flash point | 125.608°C (Cal.) |
| Refractive index | 1.554 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (2R)-1-(4-fluorophenyl)-2-aziridinecarboxylate |