|
CAS#: 93361-65-0 Product: Rishirilide A No suppilers available for the product. |
| Name | Rishirilide A |
|---|---|
| Synonyms | Rishirilide A |
| Molecular Structure | ![]() |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 |
| CAS Registry Number | 93361-65-0 |
| SMILES | [C@]124OC([C@@]([C@@H](C(C1=CC3=C(C2O)C(=CC=C3)O)=O)C)([C@]4(CCC(C)C)O)O)=O |
| InChI | 1S/C21H24O7/c1-10(2)7-8-19(26)20(27)11(3)16(23)13-9-12-5-4-6-14(22)15(12)17(24)21(13,19)28-18(20)25/h4-6,9-11,17,22,24,26-27H,7-8H2,1-3H3/t11-,17?,19+,20+,21+/m1/s1 |
| InChIKey | YKZYUGMAWQCYJT-VRLCIXGHSA-N |
| Density | 1.472g/cm3 (Cal.) |
|---|---|
| Boiling point | 566.271°C at 760 mmHg (Cal.) |
| Flash point | 198.658°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Rishirilide A |