|
CAS#: 93435-72-4 Product: 2-[(4-Methylphenyl)Sulfanyl]Indane No suppilers available for the product. |
| Name | 2-[(4-Methylphenyl)Sulfanyl]Indane |
|---|---|
| Synonyms | 2-(4-Methylphenyl)Sulfanylindane; 2-[(4-Methylphenyl)Thio]Indane; Nsc76663 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16S |
| Molecular Weight | 240.36 |
| CAS Registry Number | 93435-72-4 |
| SMILES | C1=CC=CC3=C1CC(SC2=CC=C(C=C2)C)C3 |
| InChI | 1S/C16H16S/c1-12-6-8-15(9-7-12)17-16-10-13-4-2-3-5-14(13)11-16/h2-9,16H,10-11H2,1H3 |
| InChIKey | NBRZSKZTZLPEMX-UHFFFAOYSA-N |
| Density | 1.139g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.257°C at 760 mmHg (Cal.) |
| Flash point | 170.768°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(4-Methylphenyl)Sulfanyl]Indane |