|
CAS#: 934843-28-4 Product: 2-(Difluoromethyl)-5-methoxy-1H-indole No suppilers available for the product. |
| Name | 2-(Difluoromethyl)-5-methoxy-1H-indole |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H9F2NO |
| Molecular Weight | 197.18 |
| CAS Registry Number | 934843-28-4 |
| SMILES | COc1ccc2c(c1)cc([nH]2)C(F)F |
| InChI | 1S/C10H9F2NO/c1-14-7-2-3-8-6(4-7)5-9(13-8)10(11)12/h2-5,10,13H,1H3 |
| InChIKey | YQMXVTBBCHMFFA-UHFFFAOYSA-N |
| Density | 1.282g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.582°C at 760 mmHg (Cal.) |
| Flash point | 150.102°C (Cal.) |
| Refractive index | 1.57 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Difluoromethyl)-5-methoxy-1H-indole |