|
CAS#: 93606-35-0 Product: 2-Amino-6-[(3-Chloro-4-Methyl-Phenyl)Amino]-1H-Pyrimidin-4-One No suppilers available for the product. |
| Name | 2-Amino-6-[(3-Chloro-4-Methyl-Phenyl)Amino]-1H-Pyrimidin-4-One |
|---|---|
| Synonyms | 2-Amino-6-[(3-Chloro-4-Methyl-Phenyl)Amino]-1H-Pyrimidin-4-One; Nsc52286 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11ClN4O |
| Molecular Weight | 250.69 |
| CAS Registry Number | 93606-35-0 |
| SMILES | C1=C(C=CC(=C1Cl)C)NC2=CC(N=C(N2)N)=O |
| InChI | 1S/C11H11ClN4O/c1-6-2-3-7(4-8(6)12)14-9-5-10(17)16-11(13)15-9/h2-5H,1H3,(H4,13,14,15,16,17) |
| InChIKey | VJVOAOJDSCKCJY-UHFFFAOYSA-N |
| Density | 1.48g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.718°C at 760 mmHg (Cal.) |
| Flash point | 204.614°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-6-[(3-Chloro-4-Methyl-Phenyl)Amino]-1H-Pyrimidin-4-One |