Online Database of Chemicals from Around the World
| Astatech, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (215) 785-3197 | |||
 |
sales@astatechinc.com | |||
| Chemical manufacturer since 1996 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Ethyl 4-({3-[({[(2-methyl-2-propanyl)oxy]carbonyl}amino)methyl]phenyl}amino)benzoate |
|---|---|
| Synonyms | (carbethoxyphenyl)amine; 4-[3-(ter |
| Molecular Structure | ![CAS#: 936497-81-3, Ethyl 4-({3-[({[(2-methyl-2-propanyl)oxy]carbonyl}amino)methyl]phenyl}amino)benzoate](/moreStructures/936497-81-3.gif) |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.44 |
| CAS Registry Number | 936497-81-3 |
| SMILES | CCOC(=O)c1ccc(cc1)Nc2cc(ccc2)CNC(=O)OC(C)(C)C |
| InChI | 1S/C21H26N2O4/c1-5-26-19(24)16-9-11-17(12-10-16)23-18-8-6-7-15(13-18)14-22-20(25)27-21(2,3)4/h6-13,23H,5,14H2,1-4H3,(H,22,25) |
| InChIKey | QENJSZYGBHHRGB-UHFFFAOYSA-N |
| Density | 1.154g/cm3 (Cal.) |
|---|---|
| Boiling point | 530.592°C at 760 mmHg (Cal.) |
| Flash point | 274.692°C (Cal.) |
| Refractive index | 1.57 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 4-({3-[({[(2-methyl-2-propanyl)oxy]carbonyl}amino)methyl]phenyl}amino)benzoate |