|
CAS#: 937673-92-2 Product: 2-Amino-6-nitro-1H-indole-3-carboxylic acid No suppilers available for the product. |
| Name | 2-Amino-6-nitro-1H-indole-3-carboxylic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H7N3O4 |
| Molecular Weight | 221.17 |
| CAS Registry Number | 937673-92-2 |
| SMILES | [O-][N+](=O)c1ccc2c(c1)nc(N)c2C(O)=O |
| InChI | 1S/C9H7N3O4/c10-8-7(9(13)14)5-2-1-4(12(15)16)3-6(5)11-8/h1-3,11H,10H2,(H,13,14) |
| InChIKey | JBBHXLIFNVFCKX-UHFFFAOYSA-N |
| Density | 1.721g/cm3 (Cal.) |
|---|---|
| Boiling point | 573.862°C at 760 mmHg (Cal.) |
| Flash point | 300.861°C (Cal.) |
| Refractive index | 1.826 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-6-nitro-1H-indole-3-carboxylic acid |