|
CAS#: 93768-40-2 Product: 1,6-Dihydroxy-2-Chlorophenazine No suppilers available for the product. |
| Name | 1,6-Dihydroxy-2-Chlorophenazine |
|---|---|
| Synonyms | 1,6-Dihydroxy-2-Chlorophenazine; 1,6-Phenazinediol, 2-Chloro-; 2-Chloro-1,6-Phenazinediol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H7ClN2O2 |
| Molecular Weight | 246.65 |
| CAS Registry Number | 93768-40-2 |
| SMILES | C1=CC(=C(O)C3=C1N=C2C(=CC=CC2=O)N3)Cl |
| InChI | 1S/C12H7ClN2O2/c13-6-4-5-8-11(12(6)17)15-7-2-1-3-9(16)10(7)14-8/h1-5,15,17H |
| InChIKey | VPWUZRMAUXMUOK-UHFFFAOYSA-N |
| Density | 1.606g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.066°C at 760 mmHg (Cal.) |
| Flash point | 242.321°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,6-Dihydroxy-2-Chlorophenazine |