|
CAS#: 93777-15-2 Product: 2-Bromo-4-Cyano-6-Iodophenyl Butyrate No suppilers available for the product. |
| Name | 2-Bromo-4-Cyano-6-Iodophenyl Butyrate |
|---|---|
| Synonyms | (2-Bromo-4-Cyano-6-Iodo-Phenyl) Butanoate; Butanoic Acid (2-Bromo-4-Cyano-6-Iodophenyl) Ester; Butyric Acid (2-Bromo-4-Cyano-6-Iodo-Phenyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9BrINO2 |
| Molecular Weight | 394.01 |
| CAS Registry Number | 93777-15-2 |
| EINECS | 298-044-0 |
| SMILES | C1=C(I)C(=C(Br)C=C1C#N)OC(=O)CCC |
| InChI | 1S/C11H9BrINO2/c1-2-3-10(15)16-11-8(12)4-7(6-14)5-9(11)13/h4-5H,2-3H2,1H3 |
| InChIKey | MKCUIACFRCEKRS-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for 2-Bromo-4-Cyano-6-Iodophenyl Butyrate |