|
CAS#: 93778-05-3 Product: 2-[(4-Amino-3-Ethyl-5-Methylphenyl)Methyl]-4-[(4-Aminophenyl)Methyl]Aniline No suppilers available for the product. |
| Name | 2-[(4-Amino-3-Ethyl-5-Methylphenyl)Methyl]-4-[(4-Aminophenyl)Methyl]Aniline |
|---|---|
| Synonyms | 4-[[2-Amino-5-[(4-Aminophenyl)Methyl]Phenyl]Methyl]-2-Ethyl-6-Methyl-Aniline; [4-[2-Amino-5-(4-Aminobenzyl)Benzyl]-2-Ethyl-6-Methyl-Phenyl]Amine; 2-((4-Amino-3-Ethyl-5-Methylphenyl)Methyl)-4-((4-Aminophenyl)Methyl)Aniline |
| Molecular Structure | ![]() |
| Molecular Formula | C23H27N3 |
| Molecular Weight | 345.49 |
| CAS Registry Number | 93778-05-3 |
| EINECS | 298-138-1 |
| SMILES | C3=C(CC1=C(N)C=CC(=C1)CC2=CC=C(N)C=C2)C=C(C(=C3CC)N)C |
| InChI | 1S/C23H27N3/c1-3-19-13-18(10-15(2)23(19)26)14-20-12-17(6-9-22(20)25)11-16-4-7-21(24)8-5-16/h4-10,12-13H,3,11,14,24-26H2,1-2H3 |
| InChIKey | VLTOJJNAVJHSOQ-UHFFFAOYSA-N |
| Density | 1.136g/cm3 (Cal.) |
|---|---|
| Boiling point | 560.918°C at 760 mmHg (Cal.) |
| Flash point | 323.317°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(4-Amino-3-Ethyl-5-Methylphenyl)Methyl]-4-[(4-Aminophenyl)Methyl]Aniline |