|
CAS#: 93778-38-2 Product: 2-Oxo-3-phenylpropanoic acid - L-arginine (1:1) No suppilers available for the product. |
| Name | 2-Oxo-3-phenylpropanoic acid - L-arginine (1:1) |
|---|---|
| Synonyms | L-arginine mono(α-oxobenzenepropionate) |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22N4O5 |
| Molecular Weight | 338.36 |
| CAS Registry Number | 93778-38-2 |
| EINECS | 298-174-8 |
| SMILES | O=C(Cc1ccccc1)C(O)=O.NC(=N)NCCC[C@H](N)C(O)=O |
| InChI | 1S/C9H8O3.C6H14N4O2/c10-8(9(11)12)6-7-4-2-1-3-5-7;7-4(5(11)12)2-1-3-10-6(8)9/h1-5H,6H2,(H,11,12);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t;4-/m.0/s1 |
| InChIKey | USJFALXYHGORGC-VWMHFEHESA-N |
| Boiling point | 583.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 306.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Oxo-3-phenylpropanoic acid - L-arginine (1:1) |