|
CAS#: 93778-47-3 Product: 4,8-Diamino-9,10-Dihydroanthracene-1,5,9,10-Tetrol No suppilers available for the product. |
| Name | 4,8-Diamino-9,10-Dihydroanthracene-1,5,9,10-Tetrol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 |
| CAS Registry Number | 93778-47-3 |
| EINECS | 298-184-2 |
| SMILES | C3=C(O)C1=C(C(O)C2=C(C1O)C(=CC=C2O)N)C(=C3)N |
| InChI | 1S/C14H14N2O4/c15-5-1-3-7(17)11-9(5)13(19)12-8(18)4-2-6(16)10(12)14(11)20/h1-4,13-14,17-20H,15-16H2 |
| InChIKey | NABHKBGZIKOEJG-UHFFFAOYSA-N |
| Density | 1.699g/cm3 (Cal.) |
|---|---|
| Boiling point | 591.919°C at 760 mmHg (Cal.) |
| Flash point | 311.782°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,8-Diamino-9,10-Dihydroanthracene-1,5,9,10-Tetrol |