|
CAS#: 93804-19-4 Product: 1-(6-Methyl-2-pyridinyl)-3H-pyrido[1,2-c][1,3]oxazine No suppilers available for the product. |
| Name | 1-(6-Methyl-2-pyridinyl)-3H-pyrido[1,2-c][1,3]oxazine |
|---|---|
| Synonyms | 1-(6-methyl-2-pyridyl)-1H,3H-pyrido[1,2-c][1,3]oxazine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.27 |
| CAS Registry Number | 93804-19-4 |
| EINECS | 298-393-9 |
| SMILES | Cc1cccc(n1)C3OCC=C2C=CC=CN23 |
| InChI | 1S/C14H14N2O/c1-11-5-4-7-13(15-11)14-16-9-3-2-6-12(16)8-10-17-14/h2-9,14H,10H2,1H3 |
| InChIKey | CCTGZWQVZAHXQE-UHFFFAOYSA-N |
| Density | 1.217g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.942°C at 760 mmHg (Cal.) |
| Flash point | 218.66°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(6-Methyl-2-pyridinyl)-3H-pyrido[1,2-c][1,3]oxazine |