|
CAS#: 93804-61-6 Product: 4-Isobutyl-2-Isopropylphenol No suppilers available for the product. |
| Name | 4-Isobutyl-2-Isopropylphenol |
|---|---|
| Synonyms | 4-Isobutyl-2-Isopropyl-Phenol; 4-Isobutyl-2-Isopropylphenol; 4-(2-Methylpropyl)-2-Propan-2-Yl-Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 |
| CAS Registry Number | 93804-61-6 |
| EINECS | 298-438-2 |
| SMILES | C1=C(CC(C)C)C=CC(=C1C(C)C)O |
| InChI | 1S/C13H20O/c1-9(2)7-11-5-6-13(14)12(8-11)10(3)4/h5-6,8-10,14H,7H2,1-4H3 |
| InChIKey | BPNNRHSEXOXXJY-UHFFFAOYSA-N |
| Density | 0.942g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.091°C at 760 mmHg (Cal.) |
| Flash point | 127.335°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Isobutyl-2-Isopropylphenol |