|
CAS#: 93805-19-7 Product: Methyl N-(5-acetamido-2-methoxyphenyl)-N-ethyl-beta-alaninate No suppilers available for the product. |
| Name | Methyl N-(5-acetamido-2-methoxyphenyl)-N-ethyl-beta-alaninate |
|---|---|
| Synonyms | methyl N- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 |
| CAS Registry Number | 93805-19-7 |
| EINECS | 298-501-4 |
| SMILES | COc1ccc(cc1N(CC)CCC(=O)OC)NC(C)=O |
| InChI | 1S/C15H22N2O4/c1-5-17(9-8-15(19)21-4)13-10-12(16-11(2)18)6-7-14(13)20-3/h6-7,10H,5,8-9H2,1-4H3,(H,16,18) |
| InChIKey | KNYQDMRTXCOQPL-UHFFFAOYSA-N |
| Density | 1.159g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.483°C at 760 mmHg (Cal.) |
| Flash point | 233.502°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl N-(5-acetamido-2-methoxyphenyl)-N-ethyl-beta-alaninate |