|
CAS#: 93838-90-5 Product: 2-Oxo-3-phenylpropanoic acid - L-ornithine (1:1) No suppilers available for the product. |
| Name | 2-Oxo-3-phenylpropanoic acid - L-ornithine (1:1) |
|---|---|
| Synonyms | L-ornithine (α-oxobenzenepropionate) |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 |
| CAS Registry Number | 93838-90-5 |
| EINECS | 298-762-4 |
| SMILES | O=C(Cc1ccccc1)C(O)=O.NCCC[C@H](N)C(O)=O |
| InChI | 1S/C9H8O3.C5H12N2O2/c10-8(9(11)12)6-7-4-2-1-3-5-7;6-3-1-2-4(7)5(8)9/h1-5H,6H2,(H,11,12);4H,1-3,6-7H2,(H,8,9)/t;4-/m.0/s1 |
| InChIKey | CYDIXPPRSKKSHT-VWMHFEHESA-N |
| Boiling point | 537.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 278.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Oxo-3-phenylpropanoic acid - L-ornithine (1:1) |