|
CAS#: 93840-28-9 Product: Octahydro-5,5-Dimethylnaphthalene-1-Methanol No suppilers available for the product. |
| Name | Octahydro-5,5-Dimethylnaphthalene-1-Methanol |
|---|---|
| Synonyms | Octahydro-5,5-Dimethylnaphthalene-1-Methanol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 |
| CAS Registry Number | 93840-28-9 |
| EINECS | 298-894-2 |
| SMILES | C(O)C2C1=C(C(CCC1)(C)C)CCC2 |
| InChI | 1S/C13H22O/c1-13(2)8-4-6-11-10(9-14)5-3-7-12(11)13/h10,14H,3-9H2,1-2H3 |
| InChIKey | HRHWYMCEFFZHIA-UHFFFAOYSA-N |
| Density | 0.985g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.284°C at 760 mmHg (Cal.) |
| Flash point | 116.093°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Octahydro-5,5-Dimethylnaphthalene-1-Methanol |