|
CAS#: 93840-41-6 Product: 2,2'-Sulfanediylbis[6-cyclohexyl-4-(2-methyl-2-propanyl)phenol] No suppilers available for the product. |
| Name | 2,2'-Sulfanediylbis[6-cyclohexyl-4-(2-methyl-2-propanyl)phenol] |
|---|---|
| Synonyms | 2,2'-thiobis[4-tert-butyl-6-cyclohexylphenol] |
| Molecular Structure | ![]() |
| Molecular Formula | C32H46O2S |
| Molecular Weight | 494.77 |
| CAS Registry Number | 93840-41-6 |
| EINECS | 298-905-0 |
| SMILES | CC(C)(C)c3cc(Sc1cc(cc(c1O)C2CCCCC2)C(C)(C)C)c(O)c(c3)C4CCCCC4 |
| InChI | 1S/C32H46O2S/c1-31(2,3)23-17-25(21-13-9-7-10-14-21)29(33)27(19-23)35-28-20-24(32(4,5)6)18-26(30(28)34)22-15-11-8-12-16-22/h17-22,33-34H,7-16H2,1-6H3 |
| InChIKey | QNSYHXDDRBXVHK-UHFFFAOYSA-N |
| Density | 1.111g/cm3 (Cal.) |
|---|---|
| Boiling point | 522.498°C at 760 mmHg (Cal.) |
| Flash point | 253.226°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-Sulfanediylbis[6-cyclohexyl-4-(2-methyl-2-propanyl)phenol] |