|
CAS#: 93841-31-7 Product: 3,3'-[(Dibromomethylene)disulfonyl]bis(1H-1,2,4-triazole) No suppilers available for the product. |
| Name | 3,3'-[(Dibromomethylene)disulfonyl]bis(1H-1,2,4-triazole) |
|---|---|
| Synonyms | 3,3'-[(di |
| Molecular Structure | ![]() |
| Molecular Formula | C5H4Br2N6O4S2 |
| Molecular Weight | 436.06 |
| CAS Registry Number | 93841-31-7 |
| EINECS | 299-001-9 |
| SMILES | O=S(=O)(c1ncnn1)C(Br)(Br)S(=O)(=O)c2ncnn2 |
| InChI | 1S/C5H4Br2N6O4S2/c6-5(7,18(14,15)3-8-1-10-12-3)19(16,17)4-9-2-11-13-4/h1-2H,(H,8,10,12)(H,9,11,13) |
| InChIKey | OAGYRIWYDSEJQT-UHFFFAOYSA-N |
| Density | 2.516g/cm3 (Cal.) |
|---|---|
| Boiling point | 651.811°C at 760 mmHg (Cal.) |
| Flash point | 348.003°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3'-[(Dibromomethylene)disulfonyl]bis(1H-1,2,4-triazole) |