|
CAS#: 93841-38-4 Product: 5-(tert-Butyl)-2,3-Dihydro-2,2-Dimethylbenzofuran-7-Ol No suppilers available for the product. |
| Name | 5-(tert-Butyl)-2,3-Dihydro-2,2-Dimethylbenzofuran-7-Ol |
|---|---|
| Synonyms | 5-Tert-Butyl-2,2-Dimethyl-3H-Benzofuran-7-Ol; 5-(Tert-Butyl)-2,3-Dihydro-2,2-Dimethylbenzofuran-7-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 |
| CAS Registry Number | 93841-38-4 |
| EINECS | 299-007-1 |
| SMILES | C2=C(O)C1=C(CC(O1)(C)C)C=C2C(C)(C)C |
| InChI | 1S/C14H20O2/c1-13(2,3)10-6-9-8-14(4,5)16-12(9)11(15)7-10/h6-7,15H,8H2,1-5H3 |
| InChIKey | DNTDBYLWMUNDRX-UHFFFAOYSA-N |
| Density | 1.034g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.422°C at 760 mmHg (Cal.) |
| Flash point | 117.287°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(tert-Butyl)-2,3-Dihydro-2,2-Dimethylbenzofuran-7-Ol |