|
CAS#: 93857-49-9 Product: Diammonium 3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-hexadecafluoro-9-(trifluoromethyl)decyl phosphate No suppilers available for the product. |
| Name | Diammonium 3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-hexadecafluoro-9-(trifluoromethyl)decyl phosphate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H12F19N2O4P |
| Molecular Weight | 628.17 |
| CAS Registry Number | 93857-49-9 |
| EINECS | 299-184-5 |
| SMILES | [NH4+].[NH4+].[O-]P([O-])(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | 1S/C11H6F19O4P.2H3N/c12-3(13,1-2-34-35(31,32)33)5(15,16)7(19,20)9(23,24)8(21,22)6(17,18)4(14,10(25,26)27)11(28,29)30;;/h1-2H2,(H2,31,32,33);2*1H3 |
| InChIKey | HCQGYUVUXSAUDM-UHFFFAOYSA-N |
| Boiling point | 393.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 192°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diammonium 3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-hexadecafluoro-9-(trifluoromethyl)decyl phosphate |