|
CAS#: 93858-68-5 Product: Dipotassium 4-Hydroxybutyl Phosphate No suppilers available for the product. |
| Name | Dipotassium 4-Hydroxybutyl Phosphate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C4H9K2O5P |
| Molecular Weight | 246.28 |
| CAS Registry Number | 93858-68-5 |
| EINECS | 299-302-5 |
| SMILES | C(O[P]([O-])([O-])=O)CCCO.[K+].[K+] |
| InChI | 1S/C4H11O5P.2K/c5-3-1-2-4-9-10(6,7)8;;/h5H,1-4H2,(H2,6,7,8);;/q;2*+1/p-2 |
| InChIKey | PQSDWINLVLKRMY-UHFFFAOYSA-L |
| Boiling point | 366.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 175.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dipotassium 4-Hydroxybutyl Phosphate |