|
CAS#: 93859-17-7 Product: 3-Methylbutyl 3-(3-Furyl)Acrylate No suppilers available for the product. |
| Name | 3-Methylbutyl 3-(3-Furyl)Acrylate |
|---|---|
| Synonyms | Isopentyl (E)-3-(3-Furyl)Prop-2-Enoate; (E)-3-(3-Furyl)Prop-2-Enoic Acid Isopentyl Ester; (E)-3-(3-Furyl)Acrylic Acid Isoamyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 |
| CAS Registry Number | 93859-17-7 |
| EINECS | 299-353-3 |
| SMILES | C1=C(/C=C/C(OCCC(C)C)=O)C=CO1 |
| InChI | 1S/C12H16O3/c1-10(2)5-8-15-12(13)4-3-11-6-7-14-9-11/h3-4,6-7,9-10H,5,8H2,1-2H3/b4-3+ |
| InChIKey | XKXQGYBDCCQWPU-ONEGZZNKSA-N |
| Density | 1.043g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.788°C at 760 mmHg (Cal.) |
| Flash point | 127.85°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methylbutyl 3-(3-Furyl)Acrylate |