|
CAS#: 93859-43-9 Product: 4-(4-Amino-3-methylbenzyl)-2,6-diisopropylaniline No suppilers available for the product. |
| Name | 4-(4-Amino-3-methylbenzyl)-2,6-diisopropylaniline |
|---|---|
| Synonyms | 4-[(4-amino-m-tolyl)methyl]-2,6-diisopropylaniline |
| Molecular Structure | ![]() |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.45 |
| CAS Registry Number | 93859-43-9 |
| EINECS | 299-381-6 |
| SMILES | CC(C)c1cc(cc(C(C)C)c1N)Cc2ccc(N)c(C)c2 |
| InChI | 1S/C20H28N2/c1-12(2)17-10-16(11-18(13(3)4)20(17)22)9-15-6-7-19(21)14(5)8-15/h6-8,10-13H,9,21-22H2,1-5H3 |
| InChIKey | DTXLOWXPXZWHMR-UHFFFAOYSA-N |
| Density | 1.023g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.928°C at 760 mmHg (Cal.) |
| Flash point | 263.577°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Amino-3-methylbenzyl)-2,6-diisopropylaniline |