|
CAS#: 93882-36-1 Product: 3-Methyl-1-(2,4,4-Trimethylcyclohexen-1-Yl)-2-Buten-1-One No suppilers available for the product. |
| Name | 3-Methyl-1-(2,4,4-Trimethylcyclohexen-1-Yl)-2-Buten-1-One |
|---|---|
| Synonyms | 3-Methyl-1-(2,4,4-Trimethylcyclohexen-1-Yl)-2-Buten-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 |
| CAS Registry Number | 93882-36-1 |
| EINECS | 299-432-2 |
| SMILES | CC1(CC(=C(C(=O)C=C(C)C)CC1)C)C |
| InChI | 1S/C14H22O/c1-10(2)8-13(15)12-6-7-14(4,5)9-11(12)3/h8H,6-7,9H2,1-5H3 |
| InChIKey | RLDRENCYLPKBFK-UHFFFAOYSA-N |
| Density | 0.904g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.07°C at 760 mmHg (Cal.) |
| Flash point | 116.292°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-1-(2,4,4-Trimethylcyclohexen-1-Yl)-2-Buten-1-One |