|
CAS#: 93892-41-2 Product: 6-Isopropyl-1,1,3,3-Tetramethylindan-5-Ol No suppilers available for the product. |
| Name | 6-Isopropyl-1,1,3,3-Tetramethylindan-5-Ol |
|---|---|
| Synonyms | 6-Isopropyl-1,1,3,3-Tetramethyl-Indan-5-Ol; 6-Isopropyl-1,1,3,3-Tetramethyl-5-Indanol; 6-Isopropyl-1,1,3,3-Tetramethylindan-5-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 |
| CAS Registry Number | 93892-41-2 |
| EINECS | 299-524-2 |
| SMILES | C1=C(O)C(=CC2=C1C(CC2(C)C)(C)C)C(C)C |
| InChI | 1S/C16H24O/c1-10(2)11-7-12-13(8-14(11)17)16(5,6)9-15(12,3)4/h7-8,10,17H,9H2,1-6H3 |
| InChIKey | BNMAIYLEWZZFLO-UHFFFAOYSA-N |
| Density | 0.953g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.126°C at 760 mmHg (Cal.) |
| Flash point | 139.151°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Isopropyl-1,1,3,3-Tetramethylindan-5-Ol |