|
CAS#: 93892-59-2 Product: 2,2-Dimethyl-1-(3-methylbicyclo[2.2.1]hept-5-en-2-yl)propyl acetate No suppilers available for the product. |
| Name | 2,2-Dimethyl-1-(3-methylbicyclo[2.2.1]hept-5-en-2-yl)propyl acetate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 |
| CAS Registry Number | 93892-59-2 |
| EINECS | 299-544-1 |
| SMILES | CC(C)(C)C(OC(C)=O)C2C1C=CC(C1)C2C |
| InChI | 1S/C15H24O2/c1-9-11-6-7-12(8-11)13(9)14(15(3,4)5)17-10(2)16/h6-7,9,11-14H,8H2,1-5H3 |
| InChIKey | JFYIRKUBSCIWCU-UHFFFAOYSA-N |
| Density | 0.984g/cm3 (Cal.) |
|---|---|
| Boiling point | 285.467°C at 760 mmHg (Cal.) |
| Flash point | 92.111°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dimethyl-1-(3-methylbicyclo[2.2.1]hept-5-en-2-yl)propyl acetate |