|
CAS#: 93893-37-9 Product: N-(2-Ethyl-4-Nitrophenyl)Dibenzylamine No suppilers available for the product. |
| Name | N-(2-Ethyl-4-Nitrophenyl)Dibenzylamine |
|---|---|
| Synonyms | Bis(Benzyl)-(2-Ethyl-4-Nitro-Phenyl)Amine; N-(2-Ethyl-4-Nitrophenyl)Dibenzylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 |
| CAS Registry Number | 93893-37-9 |
| EINECS | 299-625-1 |
| SMILES | C1=CC(=CC(=C1N(CC2=CC=CC=C2)CC3=CC=CC=C3)CC)[N+]([O-])=O |
| InChI | 1S/C22H22N2O2/c1-2-20-15-21(24(25)26)13-14-22(20)23(16-18-9-5-3-6-10-18)17-19-11-7-4-8-12-19/h3-15H,2,16-17H2,1H3 |
| InChIKey | KJXWPRQPTLIFSD-UHFFFAOYSA-N |
| Density | 1.18g/cm3 (Cal.) |
|---|---|
| Boiling point | 525.846°C at 760 mmHg (Cal.) |
| Flash point | 271.822°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Ethyl-4-Nitrophenyl)Dibenzylamine |