Online Database of Chemicals from Around the World
|
CAS#: 93894-32-7 Product: 1,1'-(3,7-Dimethyl-2,6-octadiene-1,1-diyl)bis(1H-indole) No suppilers available for the product. |
| Name | 1,1'-(3,7-Dimethyl-2,6-octadiene-1,1-diyl)bis(1H-indole) |
|---|---|
| Synonyms | 1,1'-(3,7-dimethylocta-2,6-dienylidene)bis(1H-indole) |
| Molecular Structure |  |
| Molecular Formula | C26H28N2 |
| Molecular Weight | 368.51 |
| CAS Registry Number | 93894-32-7 |
| EINECS | 299-729-7 |
| SMILES | C/C(C)=C\CCC(C)=CC(n2ccc1ccccc12)n4ccc3ccccc34 |
| InChI | 1S/C26H28N2/c1-20(2)9-8-10-21(3)19-26(27-17-15-22-11-4-6-13-24(22)27)28-18-16-23-12-5-7-14-25(23)28/h4-7,9,11-19,26H,8,10H2,1-3H3 |
| InChIKey | XSHXVCYGTIAJFF-UHFFFAOYSA-N |
| Density | 1.036g/cm3 (Cal.) |
|---|---|
| Boiling point | 559.003°C at 760 mmHg (Cal.) |
| Flash point | 291.874°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-(3,7-Dimethyl-2,6-octadiene-1,1-diyl)bis(1H-indole) |