|
CAS#: 93904-66-6 Product: 7-Methoxy-3,3-Dimethylindan-4-Ol No suppilers available for the product. |
| Name | 7-Methoxy-3,3-Dimethylindan-4-Ol |
|---|---|
| Synonyms | 7-Methoxy-3,3-Dimethyl-Indan-4-Ol; 7-Methoxy-3,3-Dimethyl-4-Indanol; 7-Methoxy-3,3-Dimethylindan-4-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 |
| CAS Registry Number | 93904-66-6 |
| EINECS | 299-806-5 |
| SMILES | C2=C(OC)C1=C(C(CC1)(C)C)C(=C2)O |
| InChI | 1S/C12H16O2/c1-12(2)7-6-8-10(14-3)5-4-9(13)11(8)12/h4-5,13H,6-7H2,1-3H3 |
| InChIKey | CVXVMAKCTVIFGM-UHFFFAOYSA-N |
| Density | 1.072g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.59°C at 760 mmHg (Cal.) |
| Flash point | 157.789°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Methoxy-3,3-Dimethylindan-4-Ol |