Online Database of Chemicals from Around the World
|
CAS#: 93918-03-7 Product: 4-[(2,4-Diamino-5-Methylphenyl)Amino]Phenol No suppilers available for the product. |
| Name | 4-[(2,4-Diamino-5-Methylphenyl)Amino]Phenol |
|---|---|
| Synonyms | 4-[(2,4-Diamino-5-Methyl-Phenyl)Amino]Phenol; 4-((2,4-Diamino-5-Methylphenyl)Amino)Phenol |
| Molecular Structure | ![CAS#: 93918-03-7, 4-[(2,4-Diamino-5-Methylphenyl)Amino]Phenol](/moreStructures/93918-03-7.gif) |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 |
| CAS Registry Number | 93918-03-7 |
| EINECS | 299-884-0 |
| SMILES | C1=C(C(=CC(=C1NC2=CC=C(O)C=C2)N)N)C |
| InChI | 1S/C13H15N3O/c1-8-6-13(12(15)7-11(8)14)16-9-2-4-10(17)5-3-9/h2-7,16-17H,14-15H2,1H3 |
| InChIKey | VDGHWKVBYSUBOM-UHFFFAOYSA-N |
| Density | 1.312g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.53°C at 760 mmHg (Cal.) |
| Flash point | 206.315°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(2,4-Diamino-5-Methylphenyl)Amino]Phenol |